Portal de Periódicos da CAPES

Modified Polyoxometalates: Hydrothermal Syntheses and Crystal Structures of Three Novel Reduced and Capped Keggin Derivatives Decorated by Transition Metal Complexes

2003; American Chemical Society; Volume: 42; Issue: 11 Linguagem: Inglês

10.1021/ic026296m

1520-510X

Mei Yuan, Yangguang Li, Enbo Wang, Chungui Tian, Li Wang, Changwen Hu, Ninghai Hu, Heng‐Qing Jia,

Vanadium and Halogenation Chemistry

Three novel polyoxometalate derivatives decorated by transition metal complexes have been hydrothermally synthesized. Compound 1 consists of [PMo(VI)(6)Mo(V)(2)V(IV)(8)O(44)[Co (2,2'-bipy)(2)(H(2)O)](4)](3+) polyoxocations and [PMo(VI)(4-)Mo(V)(4)V(IV)(8)O(44)[Co(2,2'-bipy)(2)(H(2)O)](2)](3-) polyoxoanions, which are both built on mixed-metal tetracapped [PMo(8)V(8)O(44)] subunits covalently bonded to four or two [Co(2,2'-bpy)(2)(H(2)O)](2+) clusters via terminal oxo groups of the capping V atoms. Compound 2 is built on [PMo(VI)(8)V(IV)(6)O(42)[Cu(I)(phen)](2)](5-) clusters constructed from mixed-metal bicapped [PMo(VI)(8)V(IV)(6)O(42)](7-) subunits covalently bonded to two [Cu(phen)](+) fragments in the similar way to 1. The structure of 3 is composed of [PMo(VI)(9)Mo(V)(3)O(40)](6-) units capped by two divalent Ni atoms via four bridging oxo groups. The crystal data for these are the following: C(120)H(126)Co(6)Mo(16)N(24)O(103)P(2)V(16) (1), triclinic P1, a = 15.6727(2) A, b = 17.3155(3) A, c = 19.5445(2) A, alpha = 86.1520(1) degrees, beta = 81.2010(1) degrees, gamma = 63.5970(1) degrees, Z = 1; C(120)H(85)Cu(6-)Mo(8)N(20)O(44)PV(6) (2), triclinic P1, a = 14.565(4) A, b = 15.899(3) A, c = 16.246(4) A, alpha = 116.289(2) degrees, beta = 103.084(2) degrees, gamma = 94.796(2) degrees, Z = 1; C(60)H(40)Mo(12)N(10)Ni(3)O(40)P (3), monoclinic P2(1)/c, a = 14.804(3) A, b = 22.137(4) A, c = 25.162(5) A, alpha = 90 degrees, beta = 98.59(3) degrees, gamma = 90 degrees, Z = 4.